Identification |
Name: | 4-Isoxazolecarboxylicacid |
Synonyms: | 4-Carboxyisoxazole;1,2-oxazole-4-carboxylic acid; |
CAS: | 6436-62-0 |
Molecular Formula: | C4H3NO3 |
Molecular Weight: | 113.0715 |
InChI: | InChI=1/C4H3NO3/c6-4(7)3-1-5-8-2-3/h1-2H,(H,6,7) |
Molecular Structure: |
 |
Properties |
Density: | 1.449 g/cm3 |
Refractive index: | 1.516 |
Appearance: | off-white to light yellow powder |
Specification: |
? 4-Isoxazolecarboxylicacid ,?its cas register number is 6436-62-0. It also can be called?1,2-Oxazole-4-carboxylic acid?;?Isoxazole-4-carboxylic acid?.?4-Isoxazolecarboxylicacid (CAS NO.6436-62-0) is a off-white to light yellow powder.
|
Safety Data |
|
 |