Identification |
Name: | decanoic acid, compound with 2,2'-iminodiethanol (1:1) |
Synonyms: | Decanoic acid, compd. with 2,2'-iminobis(ethanol) (1:1);Capric acid, diethanolamine salt;Decanoic acid, compound with 2,2'-iminodiethanol (1:1);decanoic acid - 2,2'-iminodiethanol (1:1) |
CAS: | 64601-14-5 |
EINECS: | 264-959-9 |
Molecular Formula: | C14H31NO4 |
Molecular Weight: | 277.4002 |
InChI: | InChI=1/C10H20O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-10(11)12;6-3-1-5-2-4-7/h2-9H2,1H3,(H,11,12);5-7H,1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 121.8°C |
Boiling Point: | 269.6°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 121.8°C |
Safety Data |
|
 |