Identification |
Name: | lauric acid, compound with 1,1'-iminodipropan-2-ol (1:1) |
Synonyms: | Dodecanoic acid, compd. with 1,1'-iminobis(2-propanol) (1:1);Lauric acid diisopropanolamine salt;Lauric acid, diisopropanolamine salt;Lauric acid, compound with 1,1'-iminodipropan-2-ol (1:1);dodecanoic acid - 1,1'-iminodipropan-2-ol (1:1) |
CAS: | 64608-94-2 |
EINECS: | 264-964-6 |
Molecular Formula: | C18H39NO4 |
Molecular Weight: | 333.5066 |
InChI: | InChI=1/C12H24O2.C6H15NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-5(8)3-7-4-6(2)9/h2-11H2,1H3,(H,13,14);5-9H,3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 134.1°C |
Boiling Point: | 296.1°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 134.1°C |
Safety Data |
|
 |