Identification |
Name: | 2-Propenoic acid, 2-methyl-, potassium salt, polymer with diethenylbenzene |
Synonyms: | 2-Propenoic acid, 2-methyl-, potassium salt, polymer with diethenylbenzene;Divinylbenzene, potassium methacrylate polymer;Divinylbenzene,potassium methacrylate polymer;Potassium methacrylate-divinylbenzene copolymer;Amberlite IRP-88 Ion Exchange Resin |
CAS: | 65405-55-2 |
Molecular Formula: | C14H15KO2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C10H10.C4H6O2.K/c1-3-9-7-5-6-8-10(9)4-2;1-3(2)4(5)6;/h3-8H,1-2H2;1H2,2H3,(H,5,6);/q;;+1/p-1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 71.9°C |
Boiling Point: | 207.3°C at 760 mmHg |
Flash Point: | 71.9°C |
Safety Data |
|
 |