| Identification | |
| Name: | 3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester |
| Synonyms: | S-(2,5-Dimethyl-3-furyl) 3-furothioate; 3-Furancarbothioic acid S-(2,5-dimethyl-3-furanyl) ester |
| CAS: | 65505-16-0 |
| EINECS: | 265-796-6 |
| Molecular Formula: | C11H10O3S |
| Molecular Weight: | 222.26 |
| InChI: | InChI=1/C11H9O4S/c1-5-3-7(6(2)14-5)16-8-4-9(16)15-10(8)11(12)13/h3-4H,1-2H3,(H,12,13)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.27 |
| Specification: |
2,5-Dimethyl-3-thiofuroylfuran, with the CAS registry number 65505-16-0, is also named as EINECS 265-796-6 ; FEMA No. 3481 ; S-(2,5-Dimethyl-3-furyl) 3-furothioate ; 3-Furancarbothioic acid, S-(2,5-dimethyl-3-furanyl) ester ; S-(2,5-Dimethyl-3-furyl) thio-3-furoate . It is low melting point solid. And it can be insoluble in water and slightly soluble in oil. 2,5-Dimethyl-3-thiofuroylfuran is thioester flavor. It does not exist in nature, because it is an artificial flavor. It is synthetic perfume which is used to blend fragrance. 2,5-Dimethyl-3-thiofuroylfuran can be obtained by the raw material 2,5-dimethyl-3-furanthiol, furoyl chloride and pyridine through the alcoholysis reaction. The research workers made a lot efforts to determine the optimum conditions: n (2,5-dimethyl-3-furanthiol): n (furoyl chloride): n (pyridine) = 1.0:1.5:1.5, with the ether added volume 10 mL, reaction temperature 5 °C and reaction time 1.5 h. Under these conditions, the yield is 81.3%. |
| Safety Data | |
 |
|
