| Identification |
| Name: | 2-Furancarbothioicacid, anhydrosulfide with O-(3-methylbutyl) hydrogen carbonodithioate |
| Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-(3-methylbutyl) hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-isopentyl ester;AC1MI8KA;LS-51998;O-(3-methylbutyl) furan-2-carbonylsulfanylmethanethioate;105770-06-7 |
| CAS: | 105770-06-7 |
| Molecular Formula: | C11H14 O3 S2 |
| Molecular Weight: | 258.3571 |
| InChI: | InChI=1/C11H14O3S2/c1-8(2)5-7-14-11(15)16-10(12)9-4-3-6-13-9/h3-4,6,8H,5,7H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 157.3°C |
| Boiling Point: | 336.5°Cat760mmHg |
| Density: | 1.218g/cm3 |
| Refractive index: | 1.561 |
| Flash Point: | 157.3°C |
| Safety Data |
| |
 |
