Identification |
Name: | 2-Furancarbothioicacid, anhydrosulfide with O-propyl hydrogen carbonodithioate |
Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-propyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-propyl ester;AC1MI8K1;LS-52000;O-propyl furan-2-carbonylsulfanylmethanethioate;105770-01-2 |
CAS: | 105770-01-2 |
Molecular Formula: | C9H10 O3 S2 |
Molecular Weight: | 230.3039 |
InChI: | InChI=1/C9H10O3S2/c1-2-5-12-9(13)14-8(10)7-4-3-6-11-7/h3-4,6H,2,5H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 142.9°C |
Boiling Point: | 312.6°C at 760 mmHg |
Density: | 1.289g/cm3 |
Refractive index: | 1.58 |
Flash Point: | 142.9°C |
Safety Data |
|
 |