Identification |
Name: | 2-Furancarbothioicacid, anhydrosulfide with O-2-propen-1-yl hydrogen carbonodithioate |
Synonyms: | 2-Furancarbothioicacid, anhydrosulfide with O-2-propenyl hydrogen carbonodithioate (9CI) |
CAS: | 105770-07-8 |
Molecular Formula: | C9H8 O3 S2 |
Molecular Weight: | 228.288 |
InChI: | InChI=1/C9H8O3S2/c1-2-5-12-9(13)14-8(10)7-4-3-6-11-7/h2-4,6H,1,5H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 141.8°C |
Boiling Point: | 310.9°C at 760 mmHg |
Density: | 1.314g/cm3 |
Refractive index: | 1.597 |
Flash Point: | 141.8°C |
Safety Data |
|
 |