| Identification |
| Name: | 2-Furancarbothioicacid, anhydrosulfide with O-butyl hydrogen carbonodithioate |
| Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-butyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-butyl ester;AC1MI8K4;LS-51994;O-butyl furan-2-carbonylsulfanylmethanethioate;105770-03-4 |
| CAS: | 105770-03-4 |
| Molecular Formula: | C10H12 O3 S2 |
| Molecular Weight: | 244.3305 |
| InChI: | InChI=1/C10H12O3S2/c1-2-3-6-13-10(14)15-9(11)8-5-4-7-12-8/h4-5,7H,2-3,6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 151.9°C |
| Boiling Point: | 327.6°C at 760 mmHg |
| Density: | 1.252g/cm3 |
| Refractive index: | 1.571 |
| Flash Point: | 151.9°C |
| Safety Data |
| |
 |
