Identification |
Name: | 2-Furancarbothioicacid, anhydrosulfide with O-pentyl hydrogen carbonodithioate |
Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-pentyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-pentyl ester;AC1MI8K7;LS-51999;O-pentyl furan-2-carbonylsulfanylmethanethioate;105770-05-6 |
CAS: | 105770-05-6 |
Molecular Formula: | C11H14 O3 S2 |
Molecular Weight: | 258.3571 |
InChI: | InChI=1/C11H14O3S2/c1-2-3-4-7-14-11(15)16-10(12)9-6-5-8-13-9/h5-6,8H,2-4,7H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 160.9°C |
Boiling Point: | 342.5°Cat760mmHg |
Density: | 1.22g/cm3 |
Refractive index: | 1.563 |
Flash Point: | 160.9°C |
Safety Data |
|
 |