| Identification |
| Name: | 2-Furancarbothioicacid, anhydrosulfide with O-hexyl hydrogen carbonodithioate |
| Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-hexyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-hexyl ester;AC1MI8KG;LS-51997;O-hexyl furan-2-carbonylsulfanylmethanethioate;105770-08-9 |
| CAS: | 105770-08-9 |
| Molecular Formula: | C12H16 O3 S2 |
| Molecular Weight: | 272.3836 |
| InChI: | InChI=1/C12H16O3S2/c1-2-3-4-5-8-15-12(16)17-11(13)10-7-6-9-14-10/h6-7,9H,2-5,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 169.8°C |
| Boiling Point: | 357.2°Cat760mmHg |
| Density: | 1.194g/cm3 |
| Refractive index: | 1.556 |
| Flash Point: | 169.8°C |
| Safety Data |
| |
 |
