| Identification | |
| Name: | 3-Fluorothioanisole |
| Synonyms: | Sulfide,m-fluorophenyl methyl (7CI,8CI);1-Fluoro-3-(methylthio)benzene;3-Fluorophenylmethyl sulfide;m-Fluorophenyl methyl sulfide; |
| CAS: | 658-28-6 |
| Molecular Formula: | C7H7FS |
| Molecular Weight: | 142.19 |
| InChI: | InChI=1/C7H7FOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.13 g/cm3 |
| Refractive index: | 1.539 |
| Specification: |
3-Fluorothioanisole , with CAS number of 658-28-6, can be called Sulfide,m-fluorophenyl methyl (7CI,8CI) ; 1-Fluoro-3-(methylthio)benzene ; 3-Fluorophenylmethyl sulfide ; m-Fluorophenyl methyl sulfide . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
