| Identification | |
| Name: | 2-Butenoic acid,2-methyl-, methyl ester, (2E)- |
| Synonyms: | 2-Butenoicacid, 2-methyl-, methyl ester, (E)-; Crotonic acid, 2-methyl-, methyl ester,(E)- (8CI); Tiglic acid, methyl ester (6CI,7CI); (E)-Methyl2-methyl-2-butenoate; Methyl (E)-2-methylcrotonate; Methyl tiglate; Methyltrans-2-methyl-2-butenoate; Methyl trans-2-methylcrotonate; Methyl a-methylcrotonate; NSC 55277 |
| CAS: | 6622-76-0 |
| EINECS: | 229-575-8 |
| Molecular Formula: | C6H10 O2 |
| Molecular Weight: | 114.1424 |
| InChI: | InChI=1S/C6H10O2/c1-4-5(2)6(7)8-3/h4H,1-3H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Flash Point: | 35 ºC |
| Boiling Point: | 137-138 ºC (758 mmHg) |
| Density: | 0.95 |
| Stability: | Stable. Flammable. Incompatible with strong oxidising agents. |
| Refractive index: | 1.435-1.437 |
| Water Solubility: | slight Stability Stable. Flammable. Incompatible with strong oxidising agents. Toxicology Irritant. Toxicity data (The meaning of any toxicological abbreviations |
| Solubility: | slight
|
| Appearance: | colourless liquid |
| Specification: |
Methyl tiglate ,its CAS NO. is 6622-76-0,the synonyms is Tiglic acid methyl ester ; Methyl e-2,3-dimethylacrylate ; Methyl-trans-2-methyl-2-butenoate ; Methyl tiglate ; (e)-2-Methyl-but-2-enoicacidmethylester ; 2-Butenoic acid, 2-methyl-, methyl ester, (e)- ; 2-Butenoicacid,2-methyl-,methylester,(2e)- ; 2-Carbomethoxy-2-butene, (e)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 35 ºC |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
