Identification |
Name: | cyanuric fluoride |
Synonyms: | 2,4,6-Trifluoro-1,3,5-triazine |
CAS: | 675-14-9 |
EINECS: | 211-620-8 |
Molecular Formula: | C3F3N3 |
Molecular Weight: | 135.05 |
InChI: | InChI=1/C3F3N3/c4-1-7-2(5)9-3(6)8-1 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3389 |
Melting Point: | -38ºC |
Density: | 1.57 |
Stability: | No data. |
Refractive index: | 1.348 |
Solubility: | Slightly soluble |
Appearance: | amber liquid |
Packinggroup: | I |
Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
Sensitive: | Moisture Sensitive |
Color: | Colorless |
Usage: | Fiber-reactive dyes based on cyanuric fluorides represent an emerging major application. |
Safety Data |
Hazard Symbols |
T+:Verytoxic
C:Corrosive
|
|
 |