| Identification |
| Name: | cyanuric fluoride |
| Synonyms: | 2,4,6-Trifluoro-1,3,5-triazine |
| CAS: | 675-14-9 |
| EINECS: | 211-620-8 |
| Molecular Formula: | C3F3N3 |
| Molecular Weight: | 135.05 |
| InChI: | InChI=1/C3F3N3/c4-1-7-2(5)9-3(6)8-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3389 |
| Melting Point: | -38ºC |
| Density: | 1.57 |
| Stability: | No data. |
| Refractive index: | 1.348 |
| Solubility: | Slightly soluble |
| Appearance: | amber liquid |
| Packinggroup: | I |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless |
| Usage: | Fiber-reactive dyes based on cyanuric fluorides represent an emerging major application. |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
C:Corrosive
|
| |
 |
