| Identification | |
| Name: | N-(1-Butyroxymethyl)methylnitrosamine |
| Synonyms: | methyl(butyroxymethyl)nitrosamine;Butanoic acid methyl(nitroso)aminomethyl ester |
| CAS: | 67557-56-6 |
| Molecular Formula: | C6H12N2O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H12N2O3/c1-3-4-6(9)11-5-8(2)7-10/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.6°C |
| Boiling Point: | 267.5°C at 760 mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.467 |
| Specification: |
N-(1-Butyroxymethyl)methylnitrosamine (CAS NO.67557-56-6) is also named as Methylamine, N-(1-butyroxymethyl)-N-nitroso- ; N-Nitroso-N-(1-butyroxymethyl)methyl amine ; Butyric acid, methylnitrosamino methyl ester . N-(1-Butyroxymethyl)methylnitrosamine (CAS NO.67557-56-6) is toxic. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 115.6°C |
| Safety Data | |
 |
|
