Specification: |
The CAS register number of Ethyl 5-methylimidazo[1,2-a]pyridine-2-carboxylate is 67625-35-8. It also can be called as Imidazo[1,2-a]pyridine-2-carboxylicacid, 5-methyl-, ethyl ester and the IUPAC name about this chemical is ethyl 5-methylimidazo[1,2-a]pyridine-2-carboxylate. The molecular formula about this chemical is C11H12N2O2 and molecular weight is 204.22. It belongs to the following product categories, such as Blocks; Bromides; Imidazoles; Pyridines and so on.
Physical properties about Ethyl 5-methylimidazo[1,2-a]pyridine-2-carboxylate are: (1)ACD/LogP: 2.32; (2)#H bond acceptors: 4; (3)#Freely Rotating Bonds: 3; (4)Polar Surface Area: 43.6Å2; (5)Index of Refraction: 1.584; (6)Molar Refractivity: 57.02 cm3; (7)Molar Volume: 170.1 cm3; (8)Polarizability: 22.6x10-24cm3; (9)Surface Tension: 41.9 dyne/cm.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OCC)c1nc2cccc(n2c1)C
(2)InChI: InChI=1/C11H12N2O2/c1-3-15-11(14)9-7-13-8(2)5-4-6-10(13)12-9/h4-7H,3H2,1-2H3
(3)InChIKey: XPOOAFBBNVKPCQ-UHFFFAOYAR
(4)Std. InChI: InChI=1S/C11H12N2O2/c1-3-15-11(14)9-7-13-8(2)5-4-6-10(13)12-9/h4-7H,3H2,1-2H3
(5)Std. InChIKey: XPOOAFBBNVKPCQ-UHFFFAOYSA-N
|