| Identification | |
| Name: | Imidazo[1,2-a]pyridine-2-carboxylicacid, 7-methyl-, ethyl ester |
| Synonyms: | Ethyl 7-methylimidazo[1,2-a]pyridine-2-carboxylate;7-Methyl-imidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester;Ethyl 7-methylimidazo[1,2-a]pyridine-2-carboxylate;Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, ethyl ester;7-Methyl-imidazo[1,2-a]pyridine-2-carboxylic acid; |
| CAS: | 70705-33-8 |
| Molecular Formula: | C11H12N2O2 |
| Molecular Weight: | 204.2252 |
| InChI: | InChI=1/C11H12N2O2/c1-3-15-11(14)9-7-13-5-4-8(2)6-10(13)12-9/h4-7H,3H2,1-2H3 |
| Molecular Structure: | ![(C11H12N2O2) Ethyl 7-methylimidazo[1,2-a]pyridine-2-carboxylate;7-Methyl-imidazo[1,2-a]pyridine-2-carboxylic acid...](https://img1.guidechem.com/chem/e/dict/138/70705-33-8.gif) |
| Properties | |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.585 |
| Specification: |
The Ethyl 7-methylimidazo[1,2-a]pyridine-2-carboxylate, with the cas registry number 70705-33-8, has the systematic name of ethyl 7-methylimidazo[1,2-a]pyridine-2-carboxylate. It belongs to the following product categories: Blocks; Carboxes; Pyridines. And the molecular formula of the chemical is C11H12N2O2. The characteristics of this chemical are as followings: (1)ACD/LogP: 4.03; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.014; (4)ACD/LogD (pH 7.4): 4.025; (5)ACD/BCF (pH 5.5): 657.995; (6)ACD/BCF (pH 7.4): 675.031; (7)ACD/KOC (pH 5.5): 3594.925; (8)ACD/KOC (pH 7.4): 3688.001; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 43.6 Å2; (13)Index of Refraction: 1.585; (14)Molar Refractivity: 57.02 cm3; (15)Molar Volume: 170.195 cm3; (16)Polarizability: 22.605×10-24cm3; (17)Surface Tension: 41.952 dyne/cm; (18)Density: 1.2 g/cm3. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
