Identification |
Name: | Undecylenic aldehyde digeranyl acetal |
Synonyms: | 1-Undecene, 11,11-bis(3,7-dimethyl-2,6-octadienyl)oxy- |
CAS: | 67785-74-4 |
Molecular Formula: | C31H54O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C31H54O2/c1-8-9-10-11-12-13-14-15-22-31(32-25-23-29(6)20-16-18-27(2)3)33-26-24-30(7)21-17-19-28(4)5/h8,18-19,23-24,31H,1,9-17,20-22,25-26H2,2-7H3/b29-23+,30-24+ |
Molecular Structure: |
|
Properties |
Flash Point: | 93.4°C |
Boiling Point: | 523.6°C at 760 mmHg |
Density: | 0.878g/cm3 |
Refractive index: | 1.48 |
Specification: |
Undecylenic aldehyde digeranyl acetal ,its cas register number is 67785-74-4. It also can be called 11,11-Bis-((3,7-dimethyl-2,6-octadienyl)oxy)-1-undecene ; 11,11-Digeranyloxy-1-undecene ; and 10-Undecenal digeranyl acetal .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 93.4°C |
Safety Data |
|
|