| Identification | |
| Name: | 2,2',2''-nitrilotriethanol, monoester with boric acid |
| Synonyms: | 2,2',2''-nitrilotriethanol, monoester with boric acid;2,2'-[[2-(Dihydroxyboryloxy)ethyl]imino]bisethanol;Einecs 267-073-0;Ethanol, 2,2'-((2-(boronooxy)ethyl)imino)bis-;Triethanolamine monoborate |
| CAS: | 67785-78-8 |
| EINECS: | 267-073-0 |
| Molecular Formula: | C6H16BNO5 |
| Molecular Weight: | 193.00594 |
| InChI: | InChI=1/C6H16BNO5/c9-4-1-8(2-5-10)3-6-13-7(11)12/h9-12H,1-6H2 |
| Molecular Structure: | ![(C6H16BNO5) 2,2',2''-nitrilotriethanol, monoester with boric acid;2,2'-[[2-(Dihydroxyboryloxy)ethyl]imino]biseth...](https://img.guidechem.com/structure/67785-78-8.gif) |
| Properties | |
| Flash Point: | 198.5°C |
| Boiling Point: | 404.7°C at 760 mmHg |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.497 |
| Flash Point: | 198.5°C |
| Safety Data | |
 |
|
