Identification |
Name: | 4(3H)-Pteridinone,2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-7,8-dihydro- |
Synonyms: | 7,8-Dihydrobiopterin;Dihydrobiopterin;L-erythro-7,8-Dihydrobiopterin;L-erythro-Dihydrobiopterin;1,2-Propanediol,1-(2-amino-7,8-dihydro-4-hydroxy-6-pteridinyl)-, L-erythro- (8CI);4(1H)-Pteridinone,2-amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-, [S-(R*,S*)]-;4(1H)-Pteridinone,2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-7,8-dihydro- (9CI);7,8-Dihydro-L-biopterin; |
CAS: | 6779-87-9 |
Molecular Formula: | C9H13N5O3 |
Molecular Weight: | 239.23 |
InChI: | InChI=1/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,6,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,6-/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 238.5°C |
Boiling Point: | 470.8°C at 760 mmHg |
Density: | 1.88g/cm3 |
Refractive index: | 1.821 |
Flash Point: | 238.5°C |
Storage Temperature: | −20°C |
Usage: | An oxidation producct of tetrahydrobiopterin, a naturally occurring cofactor of the aromatic amino acid hydroxylase and is involved in the synthesis of tyrosine and the neurotransmitters dopamine and serotonin. It is a noncompetitive inhibitor of G |
Safety Data |
|
 |