| Identification |
| Name: | isononanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
| Synonyms: | Isononanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Isononanoic acid, triethanolamine salt;Triethanolamine isononanoate;Isononanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);7-methyloctanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 67801-51-8 |
| EINECS: | 267-170-8 |
| Molecular Formula: | C15H33NO5 |
| Molecular Weight: | 307.4262 |
| InChI: | InChI=1/C9H18O2.C6H15NO3/c1-8(2)6-4-3-5-7-9(10)11;8-4-1-7(2-5-9)3-6-10/h8H,3-7H2,1-2H3,(H,10,11);8-10H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 129.7°C |
| Boiling Point: | 253.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 129.7°C |
| Safety Data |
| |
 |
