| Identification | |
| Name: | 3-Thiophenecarboxylicacid, 5-formyl-, methyl ester |
| Synonyms: | 5-Formylthiophene-3-carboxylicacid methyl ester;Methyl 5-formylthiophene-3-carboxylate; |
| CAS: | 67808-66-6 |
| Molecular Formula: | C7H6O3S |
| Molecular Weight: | 170.19 |
| InChI: | InChI=1/C7H6O3S/c1-5(9)10-6-2-7(3-8)11-4-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.327 g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
3-Thiophenecarboxylicacid, 5-formyl-, methyl ester , with CAS number of 67808-66-6, can be called Methyl 5-formylthiophene-3-carboxylate ; 5-Formylthiophene-3-carboxylicacid methyl ester . |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
