Identification |
Name: | 5-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid, compound with 2,2',2''-nitrilotriethanol (1:2) |
Synonyms: | 2-Cyclohexene-1-octanoic acid, 5-carboxy-4-hexyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:2);5-Carboxy-4-hexylcyclohex-2-ene-1-octanoic acid, compound with 2,2',2''-nitrilotriethanol (1:2);5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid - 2,2',2''-nitrilotriethanol (1:2) |
CAS: | 67859-77-2 |
EINECS: | 267-425-3 |
Molecular Formula: | C33H66N2O10 |
Molecular Weight: | 650.8845 |
InChI: | InChI=1/C21H36O4.2C6H15NO3/c1-2-3-4-9-12-18-15-14-17(16-19(18)21(24)25)11-8-6-5-7-10-13-20(22)23;2*8-4-1-7(2-5-9)3-6-10/h14-15,17-19H,2-13,16H2,1H3,(H,22,23)(H,24,25);2*8-10H,1-6H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 279.4°C |
Boiling Point: | 515.1°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 279.4°C |
Safety Data |
|
|