Identification |
Name: | 5-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid, compound with 2-aminoethanol (1:1) |
Synonyms: | 2-Cyclohexene-1-octanoic acid, 5-carboxy-4-hexyl-, compd. with 2-aminoethanol (1:1);5-Carboxy-4-hexyl-2-cyclohexene-1-octanoic acid ethanolamine salt (1:1);5-Carboxy-4-hexyl-2-cyclohexene-1-octanoic acid, compd. with 2-aminoethanol (1:1);5-Carboxy-4-hexyl-2-cyclohexene-1-octanoic acid, compound with 2-aminoethanol (1:1);5-Carboxy-4-hexylcyclohex-2-ene-1-octanoic acid, compound with 2-aminoethanol (1:1);5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid - 2-aminoethanol (1:1) |
CAS: | 67939-53-1 |
EINECS: | 267-841-5 |
Molecular Formula: | C23H43NO5 |
Molecular Weight: | 413.5912 |
InChI: | InChI=1/C21H36O4.C2H7NO/c1-2-3-4-9-12-18-15-14-17(16-19(18)21(24)25)11-8-6-5-7-10-13-20(22)23;3-1-2-4/h14-15,17-19H,2-13,16H2,1H3,(H,22,23)(H,24,25);4H,1-3H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 279.4°C |
Boiling Point: | 515.1°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 279.4°C |
Safety Data |
|
 |