| Identification | |
| Name: | butane-1,4-diyl bis(2-methylprop-2-enoate) - ethenyl acetate (1:1) |
| Synonyms: | AC1O5BXX;2-Propenoic acid, 2-methyl-, 1,4-butanediyl ester, polymer with ethenyl acetate;ethenyl acetate; 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;Vinyl acetate, 2-methyl-2-propenoic acid, 1,4-butanediyl ester polymer;2-Propenoic acid, 2-methyl-, 1,1'-(1,4-butanediyl) ester, polymer with ethenyl acetate;67970-04-1 |
| CAS: | 67970-04-1 |
| Molecular Formula: | C16H24O6 |
| Molecular Weight: | 312.3582 |
| InChI: | InChI=1/C12H18O4.C4H6O2/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4;1-3-6-4(2)5/h1,3,5-8H2,2,4H3;3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141.9°C |
| Boiling Point: | 292.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 141.9°C |
| Safety Data | |
 |
|
