| Identification | |
| Name: | 2-aminoethyl prop-2-enoate; nitric acid; prop-2-enamide |
| Synonyms: | AC1O5BZT;2-Propenoic acid, 2-aminoethyl ester, nitrate, polymer with 2-propenamide;2-aminoethyl prop-2-enoate; nitric acid; prop-2-enamide;2-Propenoic acid, 2-aminoethyl ester, nitrate (1:1), polymer with 2-propenamide;67990-39-0 |
| CAS: | 67990-39-0 |
| Molecular Formula: | C8H15N3O6 |
| Molecular Weight: | 249.2212 |
| InChI: | InChI=1/C5H9NO2.C3H5NO.HNO3/c1-2-5(7)8-4-3-6;1-2-3(4)5;2-1(3)4/h2H,1,3-4,6H2;2H,1H2,(H2,4,5);(H,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 50°C |
| Boiling Point: | 177.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 50°C |
| Safety Data | |
 |
|
