| Identification |
| Name: | benzene-1,2,4-tricarboxylic acid, compound with 2-phenyl-1H-imidazole-1-propiononitrile (1:1) |
| Synonyms: | 1,2,4-Benzenetricarboxylic acid, compd. with 2-phenyl-1H-imidazole-1-propanenitrile (1:1);1-Cyanoethyl-2-phenylimidazoletrimellitate (1:1);Trimellitic acid 1-cyanoethyl-2-phenylimidazole salt (1:1);Benzene-1,2,4-tricarboxylic acid, compound with 2-phenyl-1H-imidazole-1-propiononitrile (1:1);benzene-1,3,5-tricarboxylic acid - 3-(2-phenyl-1H-imidazol-1-yl)propanenitrile (1:1);benzene-1,2,4-tricarboxylic acid - 3-(2-phenyl-1H-imidazol-1-yl)propanenitrile (1:1) |
| CAS: | 68083-35-2 |
| EINECS: | 268-383-9 |
| Molecular Formula: | C21H17N3O6 |
| Molecular Weight: | 407.3762 |
| InChI: | InChI=1/C12H11N3.C9H6O6/c13-7-4-9-15-10-8-14-12(15)11-5-2-1-3-6-11;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3,5-6,8,10H,4,9H2;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 206.8°C |
| Boiling Point: | 418.3°C at 760 mmHg |
| Flash Point: | 206.8°C |
| Safety Data |
| |
 |
