| Identification | |
| Name: | Octanoic acid, mixed diesters with hexanoic acid and triethylene glycol |
| Synonyms: | Caproic acid, caprylic acid diesters with triethylene glycol;Octanoic acid mixed diesters with hexanoic acid and triethylene glycol;hexanoic acid, 2-[2-(2-hydroxyethoxy)ethoxy]ethanol; octanoic acid |
| CAS: | 68130-48-3 |
| EINECS: | 268-590-4 |
| Molecular Formula: | C20H42O8 |
| Molecular Weight: | 410.5427 |
| InChI: | InChI=1/C8H16O2.C6H14O4.C6H12O2/c1-2-3-4-5-6-7-8(9)10;7-1-3-9-5-6-10-4-2-8;1-2-3-4-5-6(7)8/h2-7H2,1H3,(H,9,10);7-8H,1-6H2;2-5H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Safety Data | |
 |
|
