| Identification | |
| Name: | Decanoic acid, mixed diesters with octanoic acid and triethylene glycol |
| Synonyms: | Caprylic, capric acid, triethylene glycol diester;Decanoic acid mixed diesters with octanoic acid and triethylene glycol;decanoic acid; 2-[2-(2-hydroxyethoxy)ethoxy]ethanol; octanoic acid |
| CAS: | 68583-52-8 |
| EINECS: | 271-517-9 |
| Molecular Formula: | C24H50O8 |
| Molecular Weight: | 466.649 |
| InChI: | InChI=1/C10H20O2.C8H16O2.C6H14O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;7-1-3-9-5-6-10-4-2-8/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);7-8H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -42.5 DEG C |
| Flash Point: | 121.8°C |
| Boiling Point: | 269.6°C at 760 mmHg |
| Flash Point: | 121.8°C |
| Safety Data | |
 |
|
