| Identification |
| Name: | Decanoic acid, mixed esters with octanoic acid and pentaerythritol |
| Synonyms: | 2,2-bis(hydroxymethyl)propane-1,3-diol; decanoic acid; octanoic acid;AC1L37EM;AC1Q5W5B;Octanoic acid, decanoic acid, pentaerythritol ester;EINECS 270-472-2;EINECS 297-011-8;AR-1D1177;Pentaerythrityl tetracaprylate/caprate;Pentaerythritol, caprylate caprate tetraester;Pentaerythritol caprylic acid capric acid mixed esters;Decanoic acid, mixed esters with octanoic acid and pentaerythritol;Decanoic acid, mixed triesters with octanoic acid and pentaerythritol;Saturated straight chain (C8 and C10) fatty acid pentaerythritol ester;68071-00-1;68441-68-9;93281-00-6 |
| CAS: | 69226-96-6 |
| Molecular Formula: | C23H48O8 |
| Molecular Weight: | 452.62242 |
| InChI: | InChI=1S/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 121.8°C |
| Boiling Point: | 269.6°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 121.8°C |
| Safety Data |
| |
 |
