| Identification |
| Name: | Amides, C16 and C18-unsatd., N,N-bis(hydroxyethyl) |
| Synonyms: | (C16 and C18)Unsaturated alkylcarboxylic acid, diethanolamide;Amides, C16 and C18-unsatd, N,N-bis(hydroxyethyl);2,2'-[(13E)-octadec-13-en-1-ylimino]diethanol |
| CAS: | 68155-08-8 |
| EINECS: | 268-936-4 |
| Molecular Formula: | C22H45NO2 |
| Molecular Weight: | 355.5982 |
| InChI: | InChI=1/C22H45NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h5-6,24-25H,2-4,7-22H2,1H3/b6-5+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 202.6°C |
| Boiling Point: | 480.5°C at 760 mmHg |
| Density: | 0.917g/cm3 |
| Refractive index: | 1.483 |
| Flash Point: | 202.6°C |
| Safety Data |
| |
 |
