Identification |
Name: | Amides, C16-18 and C18-unsatd., N,N'-ethylenebis- |
Synonyms: | N,N'-Di(C16-C18) and C18 unsaturated alkyl ethylene bisamide;Amides, C16-18 and C18-unsatd, N,N'-ethylenebis-;N,N'-(E)-ethene-1,2-diyldihexadecanamide |
CAS: | 68955-45-3 |
EINECS: | 273-277-0 |
Molecular Formula: | C34H66N2O2 |
Molecular Weight: | 534.9 |
InChI: | InChI=1/C34H66N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33(37)35-31-32-36-34(38)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h31-32H,3-30H2,1-2H3,(H,35,37)(H,36,38)/b32-31+ |
Molecular Structure: |
|
Properties |
Flash Point: | 112.5°C |
Boiling Point: | 671.8°C at 760 mmHg |
Density: | 0.898g/cm3 |
Refractive index: | 1.472 |
Flash Point: | 112.5°C |
Safety Data |
|
|