Identification |
Name: | N,N-bis(2-aminoethyl)ethane-1,2-diamine; (Z)-octadec-9-enoic acid |
Synonyms: | AC1O5CJH;EINECS 270-165-3;9-Octadecenoic acid (9Z)-, reaction products with triethylenetetramine;Oleic acid, triethylenetetramine amides;Oleic acid, triethylenetetramine reaction product;Oleic acid, reaction products with triethylene tetramine;Oleic acid, triethylenetetramine amides, acetic acid salt;9-Octadecenoic acid (Z)-, reaction products with triethylenetetramine;9-Octadecenoic acid (9Z)-, reaction products with triethylenetetramine, acetates;N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine; (Z)-octadec-9-enoic acid;68412-09-9 |
CAS: | 68412-08-8 |
Molecular Formula: | C24H52N4O2 |
Molecular Weight: | 428.69528 |
InChI: | InChI=1S/C18H34O2.C6H18N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-1-3-9-5-6-10-4-2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);9-10H,1-8H2/b10-9-; |
Molecular Structure: |
|
Properties |
Flash Point: | 270.1°C |
Boiling Point: | 360°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 270.1°C |
Safety Data |
|
|