| Identification | |
| Name: | Benzenamine, N-phenyl-,styrenated |
| Synonyms: | Styrenated N-phenyl-benzenamine |
| CAS: | 68442-68-2 |
| EINECS: | 270-485-3 |
| Molecular Formula: | C12H11N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 53-54 deg C |
| Boiling Point: | 302 deg C |
| Solubility: | 1 g dissolves in 2.2 ml of alcohol, 4 ml propyl alcohol; Freely sol in benzene, ether, glacial acetic acid, carbon disulfide. Very sol in ethanol, acetone, benzene, carbon tetrachloride, pyridine, ethyl acetate; sol in ether, acetic acid; slightly sol in chloroform Soluble in oxygenated and aromatic solvents In water, 53 mg/liter @ 20 deg C |
| Color: | Monoclinic leaflets from dilute alcohol Crystals Colorless, tan, amber, or brown crystalline solid. |
| Safety Data | |
 |
|
