| Identification |
| Name: | 9-Octadecenoic acid (Z)-, reaction products with 3-(dodecenyl)dihydro-2,5-furandione and triethylenetetramine |
| Synonyms: | 9-Octadecenoic acid (9Z)-, reaction products with 3-(dodecen-1-yl)dihydro-2,5-furandione and triethylenetetramine;Oleic acid, triethylenetetramine, dodecenylsuccinic anhydride reaction product;9-Octadecenoic acid (9Z)-, reaction products with 3-(dodecenyl)dihydro-2,5-furandione and triethylenetetramine;N,N'-bis(2-aminoethyl)ethane-1,2-diamine; 3-[(E)-dodec-1-enyl]tetrahydrofuran-2,5-dione; (Z)-octadec-9-enoic acid |
| CAS: | 68478-81-9 |
| EINECS: | 270-840-2 |
| Molecular Formula: | C40H78N4O5 |
| Molecular Weight: | 695.0711 |
| InChI: | InChI=1/C18H34O2.C16H26O3.C6H18N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18;7-1-3-9-5-6-10-4-2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);11-12,14H,2-10,13H2,1H3;9-10H,1-8H2/b10-9-;12-11+; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
