| Identification |
| Name: | 2,2-dimethylpropane-1,3-diol; stearic acid; tetradecanoic acid |
| Synonyms: | 2,2-dimethylpropane-1,3-diol;stearic acid; tetradecanoic acid;68585-01-3;AC1Q5WAC;AC1L37YN;AR-1D1581;Octadecanoic acid, mixed esters with myristic acid and neopentyl glycol;Neopentyl glycol mixed steartates and myristates;Neopentyl glycol ester of myristic and stearic acids;2,2-dimethylpropane-1,3-diol; stearic acid; tetradecanoic acid;2,2-dimethylpropane-1,3-diol; octadecanoic acid; tetradecanoic acid |
| CAS: | 68585-01-3 |
| Molecular Formula: | C37H76O6 |
| Molecular Weight: | 616.9957 |
| InChI: | InChI=1/C18H36O2.C14H28O2.C5H12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5(2,3-6)4-7/h2-17H2,1H3,(H,19,20);2-13H2,1H3,(H,15,16);6-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
