Identification |
Name: | 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, monosodium salt, reaction products with 2-heptyl-4,5-dihydro-1H-imidazole-1-ethanol |
Synonyms: | 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, sodium salt (1:1), reaction products with 2-heptyl-4,5-dihydro-1H-imidazole-1-ethanol;Caprylic acid, aminoethylethanolamine amide-imidazoline, sodium 3-chloro-2-hydroxypropanesulfonate alkylate;sodium 3-chloro-2-hydroxypropane-1-sulfonate - 2-(2-heptyl-4,5-dihydro-1H-imidazol-1-yl)ethanol (1:1:1) |
CAS: | 68610-39-9 |
EINECS: | 271-863-0 |
Molecular Formula: | C15H30ClN2NaO5S |
Molecular Weight: | 408.9169 |
InChI: | InChI=1/C12H24N2O.C3H7ClO4S.Na/c1-2-3-4-5-6-7-12-13-8-9-14(12)10-11-15;4-1-3(5)2-9(6,7)8;/h15H,2-11H2,1H3;3,5H,1-2H2,(H,6,7,8);/q;;+1/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 169.2°C |
Boiling Point: | 356.1°C at 760 mmHg |
Flash Point: | 169.2°C |
Safety Data |
|
|