Identification |
Name: | 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, monosodium salt, reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol |
Synonyms: | 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, sodium salt (1:1), reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol;sodium 3-chloro-2-hydroxypropane-1-sulfonate - 2-(2-undecyl-4,5-dihydro-1H-imidazol-1-yl)ethanol (1:1:1) |
CAS: | 70024-82-7 |
EINECS: | 274-271-0 |
Molecular Formula: | C19H38ClN2NaO5S |
Molecular Weight: | 465.0232 |
InChI: | InChI=1/C16H32N2O.C3H7ClO4S.Na/c1-2-3-4-5-6-7-8-9-10-11-16-17-12-13-18(16)14-15-19;4-1-3(5)2-9(6,7)8;/h19H,2-15H2,1H3;3,5H,1-2H2,(H,6,7,8);/q;;+1/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 202.7°C |
Boiling Point: | 411.5°C at 760 mmHg |
Flash Point: | 202.7°C |
Safety Data |
|
|