| Identification | |
| Name: | Butane, 2,2'-oxybis- |
| Synonyms: | sec-Butylether (6CI,7CI,8CI); Bis(2-butyl) ether; Di-sec-Butyl ether |
| CAS: | 6863-58-7 |
| EINECS: | 229-961-6 |
| Molecular Formula: | C8H18 O |
| Molecular Weight: | 130.26 |
| InChI: | InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1149 3/PG 3 |
| Flash Point: | 78 °F |
| Boiling Point: | 121 °C(lit.) |
| Density: | 0.759 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.394(lit.) |
| Specification: |
sec-Butyl ether (CAS NO.6863-58-7) is also called 0-01-00-00372 (Beilstein Handbook Reference) ; 2,2'-Oxybisbutane ; BRN 1733014 ; Bis(2-butyl)ether ; Di-sec-butyl ether ; Butane, 2,2'-oxybis- . sec-Butyl ether (CAS NO.6863-58-7) is high toxic. It is flammable by fire, heat and oxidants. It will produce toxic spicy smoke stimulation by heat. So the storage environment should be ventilate, low-temperature and dry. Keep sec-Butyl ether (CAS NO.6863-58-7) separate from raw materials of food and oxidants. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 78 °F |
| Safety Data | |
 |
|
