Identification |
Name: | Acetic acid ethenyl ester, polymer with ethenol, cyclic acetal with butanal |
Synonyms: | Acetic acid ethenyl ester, polymer with ethenol, cyclic acetal with butanal;Polyvinylalkohol, Reaktionsprodukt mit Mol % Butyraldehyd |
CAS: | 68648-78-2 |
Molecular Formula: | C10H18O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C4H6O2.C4H8O.C2H4O3/c1-3-6-4(2)5;1-2-3-4-5;3-1-2(4)5/h3H,1H2,2H3;4H,2-3H2,1H3;1,3-5H |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | 72.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | °C |
Safety Data |
|
|