Identification |
Name: | 18-phenyloctadecanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
Synonyms: | Benzeneoctadecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);omega-Phenylstearic acid, triethanolamine salt;18-Phenyloctadecanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);18-phenyloctadecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
CAS: | 68797-42-2 |
EINECS: | 272-297-7 |
Molecular Formula: | C30H55NO5 |
Molecular Weight: | 509.7614 |
InChI: | InChI=1/C24H40O2.C6H15NO3/c25-24(26)22-18-13-11-9-7-5-3-1-2-4-6-8-10-12-15-19-23-20-16-14-17-21-23;8-4-1-7(2-5-9)3-6-10/h14,16-17,20-21H,1-13,15,18-19,22H2,(H,25,26);8-10H,1-6H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 388.8°C |
Boiling Point: | 492.3°C at 760 mmHg |
Flash Point: | 388.8°C |
Safety Data |
|
|