Identification |
Name: | Siloxanes andSilicones, di-Me, polymers with tetrachlorophenyl silsesquioxanes |
Synonyms: | Silsesquioxanes,tetrachlorophenyl, polymers with di-Me siloxanes |
CAS: | 68957-05-1 |
Molecular Formula: | C11H15ClOSi |
Molecular Weight: | 0 |
InChI: | InChI=1/C11H15ClOSi/c12-11(10-6-2-1-3-7-10)14-9-5-4-8-13-14/h1-3,6-7,11,14H,4-5,8-9H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | -73°C |
Flash Point: | 300°C |
Boiling Point: | >300°C |
Density: | 1,05 g/cm3 |
Refractive index: | 1.428 |
Flash Point: | 300°C |
Safety Data |
|
 |