| Identification | |
| Name: | Thiophene,2-bromo-3-hexyl- |
| Synonyms: | 2-Bromo-3-hexylthiophene;2-Bromo-3-n-hexylthiophene;3-Hexyl-2-bromothiophene;2-bromo-3-hexylthiophene;thiophene, 2-bromo-3-hexyl-; |
| CAS: | 69249-61-2 |
| Molecular Formula: | C10H15BrS |
| Molecular Weight: | 247.1951 |
| InChI: | InChI=1/C10H15BrS/c1-2-3-4-5-6-9-7-8-12-10(9)11/h7-8H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Boiling Point: | 272.653°C at 760 mmHg |
| Density: | 1.240 |
| Refractive index: | 1.529 |
| Specification: |
2-Bromo-3-hexyl- thiophene with cas registry number of 69249-61-2 is also known as 2-Bromo-3-hexylthiophene ; Thiophene, 2-bromo-3-hexyl- ; 2-Bromo-3-hexyl-thiophene . 2-Bromo-3-hexyl- thiophene with cas registry number of 69249-61-2 is used as a pharmaceutical intermediate . |
| Safety Data | |
 |
|
