| Identification | |
| Name: | Benzenemethanamine,2,6-difluoro- |
| Synonyms: | (2,6-Difluorophenyl)methanamine;2,6-Difluorobenzenemethanamine; |
| CAS: | 69385-30-4 |
| EINECS: | 273-983-9 |
| Molecular Formula: | C7H7F2N |
| Molecular Weight: | 143.13 |
| InChI: | InChI=1/C7H7F2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Boiling Point: | 174-177°C |
| Density: | 1.197 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.492-1.494 |
| Solubility: | Very soluble |
| Appearance: | Colorless liquid. |
| Specification: |
Chemical Properties of 2,6-Difluorobenzylamine (CAS NO.69385-30-4): clear colorless to yellow liquid
|
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
