| Identification |
| Name: | Benzenemethanamine,2,5-difluoro- |
| Synonyms: | 2,5-Difluorobenzenemethanamine;[(2,5-Difluorophenyl)methyl]amine; |
| CAS: | 85118-06-5 |
| EINECS: | 285-658-9 |
| Molecular Formula: | C7H7F2N |
| Molecular Weight: | 143.13 |
| InChI: | InChI=1/C7H7F2N/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4,10H2 |
| Molecular Structure: |
![(C7H7F2N) 2,5-Difluorobenzenemethanamine;[(2,5-Difluorophenyl)methyl]amine;](https://img.guidechem.com/casimg/85118-06-5.gif) |
| Properties |
| Transport: | UN 2735 |
| Density: | 1.222 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.494-1.496 |
| Appearance: | Colorless to yellow clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
