Identification |
Name: | 2,4,6,8-Nonatetraenoicacid, 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-, (2Z,4E,6E,8E)- |
Synonyms: | 2,4,6,8-Nonatetraenoicacid, 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-, (Z,E,E,E)-;13-cis-Acitretin; 13-cis-Etretin; Isoacitretin; Isoetretin; Ro 13-7652 |
CAS: | 69427-46-9 |
Molecular Formula: | C21H26 O3 |
Molecular Weight: | 326.44 |
InChI: | InChI=1S/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8+,15-12- |
Molecular Structure: |
 |
Properties |
Melting Point: | 228-230 deg C |
Color: | Crystals from hexane Yellow to greenish-yellow powder |
Usage: | A synthetic retinoid which is the major metabolite of etretinate (E938000). |
Safety Data |
|
 |