Identification |
Name: | 1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one |
Synonyms: | s-Triazolo[4,3-a]pyridin-3-ol(6CI,7CI,8CI);3-Hydroxytriazolo[4,3-a]pyridine;NSC 68462; |
CAS: | 6969-71-7 |
EINECS: | 230-191-8 |
Molecular Formula: | C6H5N3O |
Molecular Weight: | 135.12 |
InChI: | InChI=1/C6H5N3O/c10-6-8-7-5-3-1-2-4-9(5)6/h1-4H,(H,8,10) |
Molecular Structure: |
|
Properties |
Melting Point: | 231°C |
Density: | 1.511 g/cm3 |
Refractive index: | 1.739 |
Appearance: | Powder |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
|
|