| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-5-carboxamide,2-methyl- |
| Synonyms: | 2-Methyl-5H-dibenzo[b,f]azepine-5-carboxamide;2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide;2-Methyl-5H-dibenzo[b,f]azepine-5-carboxamide; |
| CAS: | 70401-32-0 |
| EINECS: | 274-595-2 |
| Molecular Formula: | C16H14N2O |
| Molecular Weight: | 250.3 |
| InChI: | InChI=1/C16H14N2O/c1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)18(15)16(17)19/h2-10H,1H3,(H2,17,19) |
| Molecular Structure: | ![(C16H14N2O) 2-Methyl-5H-dibenzo[b,f]azepine-5-carboxamide;2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide;2-Methyl-...](https://img1.guidechem.com/chem/e/dict/14/70401-32-0.jpg) |
| Properties | |
| Melting Point: | 85-86?C |
| Flash Point: | 217.2°C |
| Boiling Point: | 435.6°C at 760 mmHg |
| Density: | 1.233g/cm3 |
| Refractive index: | 1.655 |
| Specification: | off-white fine powder usageEng:A new internal standard for chromatographic assays of Carbamazepine (C175840) (Tegretol). |
| Flash Point: | 217.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | A new internal standard for chromatographic assays of Carbamazepine (C175840) (Tegretol). |
| Safety Data | |
 |
|
