| Identification |
| Name: | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol |
| Synonyms: | Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol;Caprylic acid, aminoethylethanolamine reaction product;Reaction products of octanoic acid with aminoethylethanolamine;octanoic acid - 2-[(2-aminoethyl)amino]ethanol (1:1) |
| CAS: | 70750-12-8 |
| EINECS: | 274-839-8 |
| Molecular Formula: | C12H28N2O3 |
| Molecular Weight: | 248.3623 |
| InChI: | InChI=1/C8H16O2.C4H12N2O/c1-2-3-4-5-6-7-8(9)10;5-1-2-6-3-4-7/h2-7H2,1H3,(H,9,10);6-7H,1-5H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 107.4°C |
| Safety Data |
| |
 |
