| Identification | |
| Name: | 3-Thiophenecarboxylicacid, 4-methoxy- |
| Synonyms: | 4-Methoxythiophene-3-carboxylicacid;4-methoxythiophene-3-carboxylic acid;3-thiophenecarboxylic acid, 4-methoxy-;4-Methoxythiophene-3-carboxylic acid; |
| CAS: | 71050-40-3 |
| Molecular Formula: | C6H6O3S |
| Molecular Weight: | 158.18 |
| InChI: | InChI=1/C6H6O3S/c1-9-5-3-10-2-4(5)6(7)8/h2-3H,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105 °C |
| Flash Point: | 132.631°C |
| Boiling Point: | 295.693°C at 760 mmHg |
| Density: | 1.37g/cm3 |
| Refractive index: | 1.577 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 132.631°C |
| Safety Data | |
 |
|
